EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749104 - p-butylaminobenzoyldiethylaminoethyl hydrochloride
| Formula | HCl.C17H28N2O2 |
| Net Charge | 0 |
| Average Mass | 328.884 |
| Monoisotopic Mass | 328.19176 |
| SMILES | CCCCNc1ccc(C(=O)OCCN(CC)CC)cc1.Cl |
| InChI | InChI=1S/C17H28N2O2.ClH/c1-4-7-12-18-16-10-8-15(9-11-16)17(20)21-14-13-19(5-2)6-3;/h8-11,18H,4-7,12-14H2,1-3H3;1H |
| InChIKey | XTIUAXFQEAMQRU-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-butylaminobenzoyldiethylaminoethyl hydrochloride (CHEBI:749104) is a benzoate ester (CHEBI:36054) |
| Synonyms | Source |
|---|---|
| 4-diethylaminoethyl 4-butylaminobenzoate hydrochloride | ChEMBL |
| Calvital liquid | ChEMBL |
| Depolipon | ChEMBL |
| Diethylaminoethyl p-butylaminobenzoate hydrochloride | ChEMBL |
| Farmodent | ChEMBL |
| P-butylaminobenzoyldiethylaminoethyl hydrochloride | ChEMBL |