EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N3O8P |
| Net Charge | 0 |
| Average Mass | 323.198 |
| Monoisotopic Mass | 323.05185 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | IERHLVCPSMICTF-CCXZUQQUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytarabine 5'-phosphate (CHEBI:749103) has role antineoplastic agent (CHEBI:35610) |
| cytarabine 5'-phosphate (CHEBI:749103) is a pyrimidine ribonucleoside monophosphate (CHEBI:26443) |
| Synonyms | Source |
|---|---|
| Ara-5'-cmp | ChEMBL |
| Aracmp | ChEMBL |
| Aracytidine 5'-monophosphate | ChEMBL |
| Aracytidine 5'-phosphate | ChEMBL |
| Ara-cytidine monophosphate | ChEMBL |
| Cytarabine 5'-phosphate | ChEMBL |
| Citations |
|---|