EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19FN4O3 |
| Net Charge | 0 |
| Average Mass | 406.417 |
| Monoisotopic Mass | 406.14412 |
| SMILES | O=C1O[C@]2(CC[C@H](C(=O)Nc3ccn(-c4ccccc4F)n3)CC2)c2cnccc21 |
| InChI | InChI=1S/C22H19FN4O3/c23-17-3-1-2-4-18(17)27-12-8-19(26-27)25-20(28)14-5-9-22(10-6-14)16-13-24-11-7-15(16)21(29)30-22/h1-4,7-8,11-14H,5-6,9-10H2,(H,25,26,28)/t14-,22- |
| InChIKey | RMYZIRFUCOMQRH-CAJLXGCNSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-0557 (CHEBI:749102) has role anti-obesity agent (CHEBI:74518) |
| mk-0557 (CHEBI:749102) has role antipsychotic agent (CHEBI:35476) |
| mk-0557 (CHEBI:749102) is a pyrazoles (CHEBI:26410) |
| mk-0557 (CHEBI:749102) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Mk-0557 | ChEMBL |
| MK0557 | ChEMBL |
| Citations |
|---|