EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N5O4S |
| Net Charge | 0 |
| Average Mass | 413.459 |
| Monoisotopic Mass | 413.11578 |
| SMILES | O=C(NO)c1cnc(N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)nc1 |
| InChI | InChI=1S/C19H19N5O4S/c25-18(22-26)16-12-20-19(21-13-16)23-7-9-24(10-8-23)29(27,28)17-6-5-14-3-1-2-4-15(14)11-17/h1-6,11-13,26H,7-10H2,(H,22,25) |
| InChIKey | MUTBJZVSRNUIHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| r-306465 (CHEBI:749101) has role antineoplastic agent (CHEBI:35610) |
| r-306465 (CHEBI:749101) is a naphthalenes (CHEBI:25477) |
| r-306465 (CHEBI:749101) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| JNJ-16241199 | ChEMBL |
| R-306465 | ChEMBL |
| R306465 | ChEMBL |
| Citations |
|---|