EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O4 |
| Net Charge | 0 |
| Average Mass | 253.218 |
| Monoisotopic Mass | 253.08110 |
| SMILES | [N-]=[N+]=N[C@H]1C[C@H](n2ccc(=O)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C9H11N5O4/c10-13-12-5-3-8(18-6(5)4-15)14-2-1-7(16)11-9(14)17/h1-2,5-6,8,15H,3-4H2,(H,11,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | ZSNNBSPEFVIUDS-SHYZEUOFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| navuridine (CHEBI:749098) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| INNs | Source |
|---|---|
| navuridina | WHO MedNet |
| navuridine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azddu | ChEMBL |
| CS-87 | ChEMBL |
| NSC-380882 | ChEMBL |
| Citations |
|---|