EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749088 - apx-3330
| Formula | C21H30O6 |
| Net Charge | 0 |
| Average Mass | 378.465 |
| Monoisotopic Mass | 378.20424 |
| SMILES | CCCCCCCCC/C(=C\C1=C(C)C(=O)C(OC)=C(OC)C1=O)C(=O)O |
| InChI | InChI=1S/C21H30O6/c1-5-6-7-8-9-10-11-12-15(21(24)25)13-16-14(2)17(22)19(26-3)20(27-4)18(16)23/h13H,5-12H2,1-4H3,(H,24,25)/b15-13+ |
| InChIKey | AALSSIXXBDPENJ-FYWRMAATSA-N |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apx-3330 (CHEBI:749088) has role antineoplastic agent (CHEBI:35610) |
| apx-3330 (CHEBI:749088) is a ubiquinones (CHEBI:16389) |
| Synonyms | Source |
|---|---|
| APX 3330 | ChEMBL |
| APX-3330 | ChEMBL |
| APX3330 | ChEMBL |
| E 3330 | ChEMBL |
| E-3330 | ChEMBL |
| Citations |
|---|