EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O6 |
| Net Charge | 0 |
| Average Mass | 402.447 |
| Monoisotopic Mass | 402.17909 |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C21H26N2O6/c1-26-17-8-7-13(9-16(17)23-21(25)15(22)12-24)5-6-14-10-18(27-2)20(29-4)19(11-14)28-3/h5-11,15,24H,12,22H2,1-4H3,(H,23,25)/b6-5-/t15-/m0/s1 |
| InChIKey | IXWNTLSTOZFSCM-YVACAVLKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ombrabulin (CHEBI:749087) has role antineoplastic agent (CHEBI:35610) |
| ombrabulin (CHEBI:749087) is a stilbenoid (CHEBI:26776) |
| INNs | Source |
|---|---|
| ombrabulin | WHO MedNet |
| ombrabulina | WHO MedNet |
| ombrabuline | WHO MedNet |
| Synonyms | Source |
|---|---|
| AC7700 | ChEMBL |
| AVE-8062 | ChEMBL |
| AVE8062 | ChEMBL |
| Citations |
|---|