EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11FN2OS |
| Net Charge | 0 |
| Average Mass | 274.320 |
| Monoisotopic Mass | 274.05761 |
| SMILES | CNc1ccc(-c2nc3ccc(O)cc3s2)cc1F |
| InChI | InChI=1S/C14H11FN2OS/c1-16-11-4-2-8(6-10(11)15)14-17-12-5-3-9(18)7-13(12)19-14/h2-7,16,18H,1H3 |
| InChIKey | VVECGOCJFKTUAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flutemetamol (CHEBI:749082) has role antineoplastic agent (CHEBI:35610) |
| flutemetamol (CHEBI:749082) is a benzothiazoles (CHEBI:37947) |
| Synonym | Source |
|---|---|
| [3h]-flutemetamol | ChEMBL |
| Citations |
|---|