EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25F2N3O5 |
| Net Charge | 0 |
| Average Mass | 389.399 |
| Monoisotopic Mass | 389.17623 |
| SMILES | CCCC(CCC)C(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C17H25F2N3O5/c1-3-5-10(6-4-2)14(25)20-12-7-8-22(16(26)21-12)15-17(18,19)13(24)11(9-23)27-15/h7-8,10-11,13,15,23-24H,3-6,9H2,1-2H3,(H,20,21,25,26)/t11-,13-,15-/m1/s1 |
| InChIKey | MEOYFIHNRBNEPI-UXIGCNINSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly-2334737 (CHEBI:749080) has role antineoplastic agent (CHEBI:35610) |
| ly-2334737 (CHEBI:749080) is a pyrimidine nucleoside (CHEBI:26440) |
| Synonyms | Source |
|---|---|
| Ly-2334737 | ChEMBL |
| LY2334737 | ChEMBL |
| Citations |
|---|