EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O4S2 |
| Net Charge | 0 |
| Average Mass | 383.495 |
| Monoisotopic Mass | 383.09735 |
| SMILES | [H][C@]12[C@@H](C)C(SC3CN(C4=NCCS4)C3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C16H21N3O4S2/c1-7-11-10(8(2)20)14(21)19(11)12(15(22)23)13(7)25-9-5-18(6-9)16-17-3-4-24-16/h7-11,20H,3-6H2,1-2H3,(H,22,23)/t7-,8-,10-,11-/m1/s1 |
| InChIKey | GXXLUDOKHXEFBQ-YJFSRANCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebipenem (CHEBI:749078) is a carbapenems (CHEBI:46633) |
| Synonyms | Source |
|---|---|
| Ljc-11036 | ChEMBL |
| Tebipenem | ChEMBL |
| Citations |
|---|