EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32ClN3O8S |
| Net Charge | 0 |
| Average Mass | 630.119 |
| Monoisotopic Mass | 629.15986 |
| SMILES | COc1ccc(S(=O)(=O)N2C(=O)[C@@](c3ccccc3OC)(N3C[C@H](O)C[C@H]3C(=O)N(C)C)c3cc(Cl)ccc32)c(OC)c1 |
| InChI | InChI=1S/C30H32ClN3O8S/c1-32(2)28(36)24-15-19(35)17-33(24)30(21-8-6-7-9-25(21)41-4)22-14-18(31)10-12-23(22)34(29(30)37)43(38,39)27-13-11-20(40-3)16-26(27)42-5/h6-14,16,19,24,35H,15,17H2,1-5H3/t19-,24+,30+/m1/s1 |
| InChIKey | NJXZWIIMWNEOGJ-WEWKHQNJSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nelivaptan (CHEBI:749076) has role antidepressant (CHEBI:35469) |
| nelivaptan (CHEBI:749076) has role anxiolytic drug (CHEBI:35474) |
| nelivaptan (CHEBI:749076) is a proline derivative (CHEBI:26273) |
| INN | Source |
|---|---|
| nelivaptan | WHO MedNet |
| Synonyms | Source |
|---|---|
| SR-149415 | ChEMBL |
| SSR-149,415 | ChEMBL |
| SSR-149415 | ChEMBL |
| SSR149415 | ChEMBL |
| Citations |
|---|