EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22ClFN4O |
| Net Charge | 0 |
| Average Mass | 376.863 |
| Monoisotopic Mass | 376.14662 |
| SMILES | [H][C@@]12CN(C)C[C@]1([H])[C@H]2CN(Cc1ccc(F)c(Cl)c1)C(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C19H22ClFN4O/c1-23-7-13-14(8-23)15(13)9-25(19(26)18-10-24(2)11-22-18)6-12-3-4-17(21)16(20)5-12/h3-5,10-11,13-15H,6-9H2,1-2H3/t13-,14+,15+ |
| InChIKey | KYLOBHXXQOZRKK-FICVDOATSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-03463275 (CHEBI:749072) has role antipsychotic agent (CHEBI:35476) |
| pf-03463275 (CHEBI:749072) is a aromatic amide (CHEBI:62733) |
| pf-03463275 (CHEBI:749072) is a heteroarene (CHEBI:33833) |
| Synonyms | Source |
|---|---|
| Pf-03463275 | ChEMBL |
| Pf-3463275 | ChEMBL |
| Citations |
|---|