EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C11H14N4O4 |
| Net Charge | 0 |
| Average Mass | 302.718 |
| Monoisotopic Mass | 302.07818 |
| SMILES | Cl.O=c1ncnc2c([C@@H]3N[C@H](CO)[C@@H](O)[C@H]3O)cnc12 |
| InChI | InChI=1S/C11H14N4O4.ClH/c16-2-5-9(17)10(18)7(15-5)4-1-12-8-6(4)13-3-14-11(8)19;/h1,3,5,7,9-10,12,15-18H,2H2,(H,13,14,19);1H/t5-,7+,9-,10+;/m1./s1 |
| InChIKey | WEIAMZKHBCLFOG-QPAIBFMUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| forodesine hydrochloride (CHEBI:749070) has role antineoplastic agent (CHEBI:35610) |
| forodesine hydrochloride (CHEBI:749070) is a pyrrolopyrimidine (CHEBI:38670) |
| Synonyms | Source |
|---|---|
| Forodesine hcl | ChEMBL |
| Forodesine hydrochloride | ChEMBL |
| Citations |
|---|