EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N6O8 |
| Net Charge | 0 |
| Average Mass | 494.505 |
| Monoisotopic Mass | 494.21251 |
| SMILES | CC(C)C(=O)OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C21H30N6O8/c1-10(2)17(28)32-9-21(25-26-23)15(34-19(30)12(5)6)14(33-18(29)11(3)4)16(35-21)27-8-7-13(22)24-20(27)31/h7-8,10-12,14-16H,9H2,1-6H3,(H2,22,24,31)/t14-,15+,16-,21-/m1/s1 |
| InChIKey | VKXWOLCNTHXCLF-DXEZIKHYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balapiravir (CHEBI:749065) has role antiviral agent (CHEBI:22587) |
| balapiravir (CHEBI:749065) is a carbonyl compound (CHEBI:36586) |
| INN | Source |
|---|---|
| balapiravir | WHO MedNet |
| Synonyms | Source |
|---|---|
| R-1626 | ChEMBL |
| R1626 | ChEMBL |
| RO-4588161 | ChEMBL |
| RO4588161 | ChEMBL |
| Citations |
|---|