EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C4H6O6.C45H54N4O8 |
| Net Charge | 0 |
| Average Mass | 1079.119 |
| Monoisotopic Mass | 1078.42704 |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O.[H][C@]12C=C(CC)CN(Cc3c(nc4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N(C)[C@]3([H])[C@]45CCN4CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]3(O)C(=O)OC)[C@]45[H])C1)C2 |
| InChI | InChI=1S/C45H54N4O8.2C4H6O6/c1-8-27-19-28-22-44(40(51)55-6,36-30(25-48(23-27)24-28)29-13-10-11-14-33(29)46-36)32-20-31-34(21-35(32)54-5)47(4)38-43(31)16-18-49-17-12-15-42(9-2,37(43)49)39(57-26(3)50)45(38,53)41(52)56-7;2*5-1(3(7)8)2(6)4(9)10/h10-15,19-21,28,37-39,46,53H,8-9,16-18,22-25H2,1-7H3;2*1-2,5-6H,(H,7,8)(H,9,10)/t28-,37-,38+,39+,42+,43+,44-,45-;;/m0../s1 |
| InChIKey | CILBMBUYJCWATM-UDRBCWGGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinorelbine tartrate (CHEBI:749064) has role antineoplastic agent (CHEBI:35610) |
| vinorelbine tartrate (CHEBI:749064) is a vinca alkaloid (CHEBI:27288) |
| Synonyms | Source |
|---|---|
| Liposomal vinorelbine tartrate | ChEMBL |
| TLC-178 | ChEMBL |
| TLC178 | ChEMBL |
| Vinorelbine (as tartrate) | ChEMBL |
| Vinorelbine liposomal | ChEMBL |
| Vinorelbine tartrate (1:2) | ChEMBL |
| Citations |
|---|