EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N8O |
| Net Charge | 0 |
| Average Mass | 460.586 |
| Monoisotopic Mass | 460.26991 |
| SMILES | CNC(=O)c1nn(C)c2c1C(C)(C)Cc1cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc1-2 |
| InChI | InChI=1S/C25H32N8O/c1-25(2)14-16-15-27-24(29-20(16)22-19(25)21(23(34)26-3)30-32(22)5)28-17-6-8-18(9-7-17)33-12-10-31(4)11-13-33/h6-9,15H,10-14H2,1-5H3,(H,26,34)(H,27,28,29) |
| InChIKey | RXZMYLDMFYNEIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milciclib (CHEBI:749060) has role antineoplastic agent (CHEBI:35610) |
| milciclib (CHEBI:749060) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| milciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| PHA 848125 | ChEMBL |
| PHA-848125 | ChEMBL |
| Citations |
|---|