EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17FN2O2 |
| Net Charge | 0 |
| Average Mass | 348.377 |
| Monoisotopic Mass | 348.12741 |
| SMILES | Cc1c(Cc2ccc3ccccc3n2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C21H17FN2O2/c1-13-17(11-16-8-6-14-4-2-3-5-19(14)23-16)18-10-15(22)7-9-20(18)24(13)12-21(25)26/h2-10H,11-12H2,1H3,(H,25,26) |
| InChIKey | FATGTHLOZSXOBC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| timapiprant (CHEBI:749059) has role anti-asthmatic agent (CHEBI:65023) |
| timapiprant (CHEBI:749059) has role dermatologic drug (CHEBI:50177) |
| timapiprant (CHEBI:749059) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| timapiprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| CHF-6532 | ChEMBL |
| OC-000459 | ChEMBL |
| OC000459 | ChEMBL |
| Oc-459 | ChEMBL |
| OC459 | ChEMBL |
| Odc-9101 | ChEMBL |
| Citations |
|---|