EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N4O |
| Net Charge | 0 |
| Average Mass | 392.462 |
| Monoisotopic Mass | 392.16371 |
| SMILES | Cn1cc(-c2ccncc2)c(-c2ccc(OCc3ccc4ccccc4n3)cc2)n1 |
| InChI | InChI=1S/C25H20N4O/c1-29-16-23(18-12-14-26-15-13-18)25(28-29)20-7-10-22(11-8-20)30-17-21-9-6-19-4-2-3-5-24(19)27-21/h2-16H,17H2,1H3 |
| InChIKey | AZEXWHKOMMASPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mardepodect (CHEBI:749055) has role antipsychotic agent (CHEBI:35476) |
| mardepodect (CHEBI:749055) is a pyrazoles (CHEBI:26410) |
| mardepodect (CHEBI:749055) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| mardepodect | WHO MedNet |
| Synonyms | Source |
|---|---|
| MP-10 | ChEMBL |
| PF-02545920 | ChEMBL |
| PF-2545920 | ChEMBL |
| Citations |
|---|