EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749053 - torcitabine
| Formula | C9H13N3O4 |
| Net Charge | 0 |
| Average Mass | 227.220 |
| Monoisotopic Mass | 227.09061 |
| SMILES | Nc1ccn([C@@H]2C[C@@H](O)[C@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m1/s1 |
| InChIKey | CKTSBUTUHBMZGZ-CHKWXVPMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torcitabine (CHEBI:749053) is a pyrimidine nucleoside (CHEBI:26440) |
| INNs | Source |
|---|---|
| torcitabina | WHO MedNet |
| torcitabine | WHO MedNet |
| Synonym | Source |
|---|---|
| NV-02C | ChEMBL |
| Citations |
|---|