EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C21H26N2O3 |
| Net Charge | 0 |
| Average Mass | 390.911 |
| Monoisotopic Mass | 390.17102 |
| SMILES | Cl.[H][C@@]12CC[C@H](O)[C@H](C(=O)OC)[C@@]1([H])C[C@@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C21H26N2O3.ClH/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24;/h2-5,12,15,17-19,22,24H,6-11H2,1H3;1H/t12-,15-,17-,18-,19+;/m0./s1 |
| InChIKey | PIPZGJSEDRMUAW-VJDCAHTMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yohimbine hydrochloride (CHEBI:749043) has role antidepressant (CHEBI:35469) |
| yohimbine hydrochloride (CHEBI:749043) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| NSC-19509 | ChEMBL |
| Brand Names | Source |
|---|---|
| Prowess plain | ChEMBL |
| Yocon | ChEMBL |
| Citations |
|---|