EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O2 |
| Net Charge | 0 |
| Average Mass | 340.467 |
| Monoisotopic Mass | 340.21508 |
| SMILES | [H][C@@]12CCN(C[C@@H]1CC)[C@]([H])([C@H](O)c1ccnc3ccc(OCC)cc13)C2 |
| InChI | InChI=1S/C21H28N2O2/c1-3-14-13-23-10-8-15(14)11-20(23)21(24)17-7-9-22-19-6-5-16(25-4-2)12-18(17)19/h5-7,9,12,14-15,20-21,24H,3-4,8,10-11,13H2,1-2H3/t14-,15-,20-,21+/m0/s1 |
| InChIKey | SUWZHLCNFQWNPE-LATRNWQMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylhydrocupreine (CHEBI:749019) is a cinchona alkaloid (CHEBI:51323) |
| Synonyms | Source |
|---|---|
| GNF-Pf-5532 | ChEMBL |
| Hydrocinchonidine, 6'-ethoxy- | ChEMBL |
| Hydrocupreine, ethyl ether | ChEMBL |
| Hydrocupreine, o6'-ethyl- | ChEMBL |
| Optochin | ChEMBL |
| Citations |
|---|