EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O |
| Net Charge | 0 |
| Average Mass | 190.246 |
| Monoisotopic Mass | 190.11061 |
| SMILES | [H][C@@]12CNC[C@@]([H])(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
| InChIKey | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytisinicline (CHEBI:749015) has role renoprotective agent (CHEBI:231911) |
| cytisinicline (CHEBI:749015) is a alkaloid (CHEBI:22315) |
| INNs | Source |
|---|---|
| citisiniclina | WHO MedNet |
| cytisinicline | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6039 Sopharma | ChEMBL |
| Cytiton | ChEMBL |
| NSC-407282 | ChEMBL |
| Ulexine | ChEMBL |
| Brand Name | Source |
|---|---|
| Tabex | ChEMBL |
| Citations |
|---|