EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31F2N3O2 |
| Net Charge | 0 |
| Average Mass | 527.615 |
| Monoisotopic Mass | 527.23843 |
| SMILES | [H][C@@]12c3ccccc3[C@@H](N3CCN(C[C@@H](O)COc4cccc5ncccc45)CC3)c3ccccc3[C@]1([H])C2(F)F |
| InChI | InChI=1S/C32H31F2N3O2/c33-32(34)29-22-7-1-3-9-24(22)31(25-10-4-2-8-23(25)30(29)32)37-17-15-36(16-18-37)19-21(38)20-39-28-13-5-12-27-26(28)11-6-14-35-27/h1-14,21,29-31,38H,15-20H2/t21-,29-,30+,31-/m1/s1 |
| InChIKey | IHOVFYSQUDPMCN-DBEBIPAYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zosuquidar (CHEBI:749003) has role antineoplastic agent (CHEBI:35610) |
| zosuquidar (CHEBI:749003) is a organic tricyclic compound (CHEBI:51959) |
| INN | Source |
|---|---|
| zosuquidar | WHO MedNet |
| Citations |
|---|