EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18N4O3 |
| Net Charge | 0 |
| Average Mass | 422.444 |
| Monoisotopic Mass | 422.13789 |
| SMILES | O=C(NC1CC1)c1cn(-c2cccc(C#Cc3ccc[n+]([O-])c3)c2)c2ncccc2c1=O |
| InChI | InChI=1S/C25H18N4O3/c30-23-21-7-2-12-26-24(21)29(16-22(23)25(31)27-19-10-11-19)20-6-1-4-17(14-20)8-9-18-5-3-13-28(32)15-18/h1-7,12-16,19H,10-11H2,(H,27,31) |
| InChIKey | JJWKQXNHYDJXKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsoriatic A drug used to treat psoriasis. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-0873 (CHEBI:748999) has role antipsoriatic (CHEBI:50748) |
| mk-0873 (CHEBI:748999) has role antirheumatic drug (CHEBI:35842) |
| mk-0873 (CHEBI:748999) is a naphthyridine derivative (CHEBI:73539) |
| Synonyms | Source |
|---|---|
| Mk-0873 | ChEMBL |
| MK0873 | ChEMBL |
| Citations |
|---|