EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H58N10O9S2 |
| Net Charge | 0 |
| Average Mass | 947.154 |
| Monoisotopic Mass | 946.38297 |
| SMILES | [H][C@]1(NC(=O)[C@H](N)Cc2ccccc2)CSSC[C@@]([H])(C(=O)N[C@]([H])(C(N)=O)[C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2cnc3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C45H58N10O9S2/c1-25(56)38(39(48)58)55-45(64)37-24-66-65-23-36(53-40(59)31(47)19-26-9-3-2-4-10-26)44(63)51-34(20-27-14-16-29(57)17-15-27)42(61)52-35(21-28-22-49-32-12-6-5-11-30(28)32)43(62)50-33(41(60)54-37)13-7-8-18-46/h2-6,9-12,14-17,22,25,31,33-38,49,56-57H,7-8,13,18-21,23-24,46-47H2,1H3,(H2,48,58)(H,50,62)(H,51,63)(H,52,61)(H,53,59)(H,54,60)(H,55,64)/t25-,31-,33+,34+,35-,36+,37+,38+/m1/s1 |
| InChIKey | SNAJPQVDGYDQSW-DYCFWDQMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tt-232 (CHEBI:748996) has role antineoplastic agent (CHEBI:35610) |
| tt-232 (CHEBI:748996) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| TLN-232 | ChEMBL |
| Tt-232 | ChEMBL |
| Citations |
|---|