EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29BrO2 |
| Net Charge | 0 |
| Average Mass | 369.343 |
| Monoisotopic Mass | 368.13509 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)[C@H](Br)C[C@@]34[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H29BrO2/c1-18-7-5-12(21)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(20)17(19)22/h11-16,21H,3-10H2,1-2H3/t11-,12-,13+,14-,15-,16+,18-,19-/m0/s1 |
| InChIKey | CWVMWSZEMZOUPC-JUAXIXHSSA-N |
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16.alpha.-bromoepiandrosterone (CHEBI:748994) has role androgen (CHEBI:50113) |
| 16.alpha.-bromoepiandrosterone (CHEBI:748994) has role anti-HIV agent (CHEBI:64946) |
| 16.alpha.-bromoepiandrosterone (CHEBI:748994) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 16.alpha.-bromoepiandrosterone | ChEMBL |
| HE-2000 | ChEMBL |
| HE2000 | ChEMBL |
| Citations |
|---|