EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748990 - denufosol
| Formula | C18H27N5O21P4 |
| Net Charge | 0 |
| Average Mass | 773.324 |
| Monoisotopic Mass | 773.01490 |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4ccc(=O)nc4=O)[C@H](O)[C@@H]3O)O2)c(=O)n1 |
| InChI | InChI=1S/C18H27N5O21P4/c19-11-1-3-22(17(28)20-11)13-5-8(24)9(40-13)6-38-45(30,31)42-47(34,35)44-48(36,37)43-46(32,33)39-7-10-14(26)15(27)16(41-10)23-4-2-12(25)21-18(23)29/h1-4,8-10,13-16,24,26-27H,5-7H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)(H2,19,20,28)(H,21,25,29)/t8-,9+,10+,13+,14+,15+,16+/m0/s1 |
| InChIKey | FPNPSEMJLALQSA-MIYUEGBISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| denufosol (CHEBI:748990) is a pyrimidine ribonucleotide (CHEBI:26446) |
| INN | Source |
|---|---|
| denufosol | WHO MedNet |
| Citations |
|---|