EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14NO3 |
| Net Charge | 0 |
| Average Mass | 226.238 |
| Monoisotopic Mass | 226.09831 |
| SMILES | N[C@@H](Cc1ccc(OCC[18F])cc1)C(=O)O |
| InChI | InChI=1S/C11H14FNO3/c12-5-6-16-9-3-1-8(2-4-9)7-10(13)11(14)15/h1-4,10H,5-7,13H2,(H,14,15)/t10-/m0/s1/i12-1 |
| InChIKey | QZZYPHBVOQMBAT-LRAGLOQXSA-N |
| Roles Classification |
|---|
| Applications: | diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| floretyrosine f18 (CHEBI:748989) has role antineoplastic agent (CHEBI:35610) |
| floretyrosine f18 (CHEBI:748989) has role diagnostic imaging agent (CHEBI:37334) |
| floretyrosine f18 (CHEBI:748989) is a phenylalanine derivative (CHEBI:25985) |
| Synonyms | Source |
|---|---|
| 18f-fet | ChEMBL |
| (18f)fluoroethyltyrosine | ChEMBL |
| 2-fluoroethyltyrosine f-18 | ChEMBL |
| Fet f-18 | ChEMBL |
| Floretyrosine f18 | ChEMBL |
| Fluoroethyl-l-tyrosine (18f) | ChEMBL |
| Citations |
|---|