EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O2S |
| Net Charge | 0 |
| Average Mass | 340.448 |
| Monoisotopic Mass | 340.12455 |
| SMILES | Cc1c(N)cccc1Cn1ccc(OCCc2cccs2)cc1=O |
| InChI | InChI=1S/C19H20N2O2S/c1-14-15(4-2-6-18(14)20)13-21-9-7-16(12-19(21)22)23-10-8-17-5-3-11-24-17/h2-7,9,11-12H,8,10,13,20H2,1H3 |
| InChIKey | YCLREGRRHGLOAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cg-400549 (CHEBI:748986) has role dermatologic drug (CHEBI:50177) |
| cg-400549 (CHEBI:748986) is a pyridone (CHEBI:38183) |
| INN | Source |
|---|---|
| nilofabicin | WHO MedNet |
| Synonyms | Source |
|---|---|
| CG-400459 | ChEMBL |
| CG-400549 | ChEMBL |
| CG400549 | ChEMBL |
| Citations |
|---|