EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748972 - dovitinib
| Formula | C21H21FN6O |
| Net Charge | 0 |
| Average Mass | 392.438 |
| Monoisotopic Mass | 392.17609 |
| SMILES | CN1CCN(c2ccc3nc(-c4c(N)c5c(F)cccc5nc4=O)nc3c2)CC1 |
| InChI | InChI=1S/C21H21FN6O/c1-27-7-9-28(10-8-27)12-5-6-14-16(11-12)25-20(24-14)18-19(23)17-13(22)3-2-4-15(17)26-21(18)29/h2-6,11H,7-10H2,1H3,(H,24,25)(H3,23,26,29) |
| InChIKey | PIQCTGMSNWUMAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dovitinib (CHEBI:748972) has role antineoplastic agent (CHEBI:35610) |
| dovitinib (CHEBI:748972) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| dovitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CHIR-258 | ChEMBL |
| GFKI-258 | ChEMBL |
| NVP-TKI258 | ChEMBL |
| TKI-258 | ChEMBL |
| Citations |
|---|