EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N2O3 |
| Net Charge | 0 |
| Average Mass | 416.606 |
| Monoisotopic Mass | 416.30389 |
| SMILES | CCCCCCCCN1CCc2c(C)c(CC(=O)O)c(C)c(NC(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C25H40N2O3/c1-7-8-9-10-11-12-14-27-15-13-19-17(2)20(16-21(28)29)18(3)22(23(19)27)26-24(30)25(4,5)6/h7-16H2,1-6H3,(H,26,30)(H,28,29) |
| InChIKey | TXIIZHHIOHVWJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pactimibe (CHEBI:748967) has role antiatherosclerotic agent (CHEBI:145947) |
| pactimibe (CHEBI:748967) has role cardiovascular drug (CHEBI:35554) |
| pactimibe (CHEBI:748967) is a indoles (CHEBI:24828) |
| INNs | Source |
|---|---|
| pactimiba | WHO MedNet |
| pactimibe | WHO MedNet |
| Citations |
|---|