EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24F3N3O2 |
| Net Charge | 0 |
| Average Mass | 431.458 |
| Monoisotopic Mass | 431.18206 |
| SMILES | Cc1nc2cccc(C(F)(F)F)c2c(=O)n1-c1ccc(OCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C23H24F3N3O2/c1-16-27-20-7-4-6-19(23(24,25)26)21(20)22(30)29(16)17-8-10-18(11-9-17)31-15-5-14-28-12-2-3-13-28/h4,6-11H,2-3,5,12-15H2,1H3 |
| InChIKey | DDDZBLNULGDPGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-0249 (CHEBI:748965) has role antipsychotic agent (CHEBI:35476) |
| mk-0249 (CHEBI:748965) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Mk-0249 | ChEMBL |
| MK0249 | ChEMBL |
| Citations |
|---|