EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O9 |
| Net Charge | 0 |
| Average Mass | 390.344 |
| Monoisotopic Mass | 390.09508 |
| SMILES | COC(=O)c1cc(OC)c2c(c1-c1c(CO)cc(OC)c3c1OCO3)OCO2 |
| InChI | InChI=1S/C19H18O9/c1-22-11-4-9(6-20)13(17-15(11)25-7-27-17)14-10(19(21)24-3)5-12(23-2)16-18(14)28-8-26-16/h4-5,20H,6-8H2,1-3H3 |
| InChIKey | KXMTXZACPVCDMH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | vulnerary A drug used in treating and healing of wounds. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bicyclol (CHEBI:748956) has role vulnerary (CHEBI:73336) |
| bicyclol (CHEBI:748956) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| Bicyclol | ChEMBL |
| Citations |
|---|