EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27NO10 |
| Net Charge | 0 |
| Average Mass | 513.499 |
| Monoisotopic Mass | 513.16350 |
| SMILES | [H][C@]1(O[C@H]2C[C@H](N)[C@H](O)[C@H](C)O2)C[C@](O)(C(C)=O)Cc2c(O)c3c(c(O)c21)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C26H27NO10/c1-9-21(30)13(27)6-16(36-9)37-15-8-26(35,10(2)28)7-12-18(15)25(34)20-19(23(12)32)22(31)11-4-3-5-14(29)17(11)24(20)33/h3-5,9,13,15-16,21,29-30,32,34-35H,6-8,27H2,1-2H3/t9-,13-,15-,16-,21+,26-/m0/s1 |
| InChIKey | XREUEWVEMYWFFA-CSKJXFQVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carubicin (CHEBI:748955) is a anthracycline (CHEBI:48120) |
| INNs | Source |
|---|---|
| carubicina | WHO MedNet |
| carubicine | WHO MedNet |
| Synonym | Source |
|---|---|
| NSC-180024 | ChEMBL |
| Citations |
|---|