EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2 |
| Net Charge | 0 |
| Average Mass | 198.269 |
| Monoisotopic Mass | 198.11570 |
| SMILES | N[C@@H](Cc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2/c14-13(11-6-2-1-3-7-11)10-12-8-4-5-9-15-12/h1-9,13H,10,14H2/t13-/m0/s1 |
| InChIKey | FWUQWDCOOWEXRY-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanicemine (CHEBI:748954) has role antidepressant (CHEBI:35469) |
| lanicemine (CHEBI:748954) is a organohalogen compound (CHEBI:17792) |
| lanicemine (CHEBI:748954) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| lanicemina | WHO MedNet |
| lanicemine | WHO MedNet |
| Synonyms | Source |
|---|---|
| AR-R15896AR | ChEMBL |
| AZD-6765 | ChEMBL |
| AZD6765 | ChEMBL |
| Citations |
|---|