EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748953 - oleylphosphocholine
| Formula | C23H48NO4P |
| Net Charge | 0 |
| Average Mass | 433.614 |
| Monoisotopic Mass | 433.33210 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C23H48NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-27-29(25,26)28-23-21-24(2,3)4/h12-13H,5-11,14-23H2,1-4H3/b13-12- |
| InChIKey | SLVOKEOPLJCHCQ-SEYXRHQNSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleylphosphocholine (CHEBI:748953) has role antileishmanial agent (CHEBI:70868) |
| oleylphosphocholine (CHEBI:748953) is a phosphocholines (CHEBI:36700) |
| Synonym | Source |
|---|---|
| Oleylphosphocholine | ChEMBL |
| Citations |
|---|