EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748950 - verubulin
| Formula | C17H17N3O |
| Net Charge | 0 |
| Average Mass | 279.343 |
| Monoisotopic Mass | 279.13716 |
| SMILES | COc1ccc(N(C)c2nc(C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C17H17N3O/c1-12-18-16-7-5-4-6-15(16)17(19-12)20(2)13-8-10-14(21-3)11-9-13/h4-11H,1-3H3 |
| InChIKey | SNHCRNMVYDHVDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verubulin (CHEBI:748950) has role antineoplastic agent (CHEBI:35610) |
| verubulin (CHEBI:748950) is a aromatic amine (CHEBI:33860) |
| verubulin (CHEBI:748950) is a tertiary amino compound (CHEBI:50996) |
| INNs | Source |
|---|---|
| verubulin | WHO MedNet |
| verubulina | WHO MedNet |
| verubuline | WHO MedNet |
| Synonyms | Source |
|---|---|
| MPC-6827 | ChEMBL |
| MX-128495 | ChEMBL |
| Brand Name | Source |
|---|---|
| Azixa | ChEMBL |
| Citations |
|---|