EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27F4N3O3S |
| Net Charge | 0 |
| Average Mass | 525.568 |
| Monoisotopic Mass | 525.17093 |
| SMILES | CC(C)(F)C[C@H](N[C@@H](c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(F)(F)F)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C25H27F4N3O3S/c1-23(2,26)14-20(22(33)32-24(15-30)12-13-24)31-21(25(27,28)29)18-6-4-16(5-7-18)17-8-10-19(11-9-17)36(3,34)35/h4-11,20-21,31H,12-14H2,1-3H3,(H,32,33)/t20-,21-/m0/s1 |
| InChIKey | FWIVDMJALNEADT-SFTDATJTSA-N |
| Roles Classification |
|---|
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odanacatib (CHEBI:748946) has role antineoplastic agent (CHEBI:35610) |
| odanacatib (CHEBI:748946) has role bone density conservation agent (CHEBI:50646) |
| odanacatib (CHEBI:748946) is a leucine derivative (CHEBI:47003) |
| INN | Source |
|---|---|
| odanacatib | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-001037536 | ChEMBL |
| L-1037536 | ChEMBL |
| MK-0822 | ChEMBL |
| MK0822 | ChEMBL |
| Citations |
|---|