EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N7O |
| Net Charge | 0 |
| Average Mass | 321.344 |
| Monoisotopic Mass | 321.13381 |
| SMILES | Cc1cc(Cn2nnc3c(-c4ccco4)nc(N)nc32)ccc1N |
| InChI | InChI=1S/C16H15N7O/c1-9-7-10(4-5-11(9)17)8-23-15-14(21-22-23)13(19-16(18)20-15)12-3-2-6-24-12/h2-7H,8,17H2,1H3,(H2,18,19,20) |
| InChIKey | HQSBCDPYXDGTCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vipadenant (CHEBI:748942) has role antiparkinson drug (CHEBI:48407) |
| vipadenant (CHEBI:748942) is a triazolopyrimidines (CHEBI:48435) |
| INN | Source |
|---|---|
| vipadenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| BIIB-014 | ChEMBL |
| BIIB014 | ChEMBL |
| CEB-4520 | ChEMBL |
| V-2006 | ChEMBL |
| V2006 | ChEMBL |
| VER-11135 | ChEMBL |
| Citations |
|---|