EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748937 - tipindole
| Formula | C16H20N2O2S |
| Net Charge | 0 |
| Average Mass | 304.415 |
| Monoisotopic Mass | 304.12455 |
| SMILES | CN(C)CCOC(=O)c1ccc2nc3c(c2c1)CSCC3 |
| InChI | InChI=1S/C16H20N2O2S/c1-18(2)6-7-20-16(19)11-3-4-14-12(9-11)13-10-21-8-5-15(13)17-14/h3-4,9,17H,5-8,10H2,1-2H3 |
| InChIKey | WNDHLINIYZAWCR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipindole (CHEBI:748937) is a indolyl carboxylic acid (CHEBI:46867) |
| INNs | Source |
|---|---|
| tipindol | WHO MedNet |
| tipindole | WHO MedNet |
| Citations |
|---|