EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29N3O2 |
| Net Charge | 0 |
| Average Mass | 331.460 |
| Monoisotopic Mass | 331.22598 |
| SMILES | Cc1c(C)n(CCN(C)C)c2ccc(C(=O)OCCN(C)C)cc12 |
| InChI | InChI=1S/C19H29N3O2/c1-14-15(2)22(10-9-20(3)4)18-8-7-16(13-17(14)18)19(23)24-12-11-21(5)6/h7-8,13H,9-12H2,1-6H3 |
| InChIKey | LOCIGFDPZFJXFT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amindocate (CHEBI:748934) is a indolyl carboxylic acid (CHEBI:46867) |
| INNs | Source |
|---|---|
| amindocate | WHO MedNet |
| amindocato | WHO MedNet |
| Citations |
|---|