EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HO4S.C20H18NO4 |
| Net Charge | 0 |
| Average Mass | 433.438 |
| Monoisotopic Mass | 433.08314 |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.O=S(=O)([O-])O |
| InChI | InChI=1S/C20H18NO4.H2O4S/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;1-5(2,3)4/h3-4,7-10H,5-6,11H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | JISRTQBQFQMSLG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| berberine sulfate (CHEBI:748926) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| Berberine sulfate | ChEMBL |
| Berberine sulfate (2:1) | ChEMBL |
| Berberine sulfate anhydrous | ChEMBL |
| Berberine sulphate | ChEMBL |
| Erben | ChEMBL |
| Neutral berberine sulfate | ChEMBL |
| Citations |
|---|