EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C29H40N2O4.HCl |
| Net Charge | 0 |
| Average Mass | 553.571 |
| Monoisotopic Mass | 552.25216 |
| SMILES | Cl.Cl.[H][C@@]12C[C@H](C[C@H]3NCCc4cc(OC)c(OC)cc43)[C@@H](CC)CN1CCc1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C29H40N2O4.2ClH/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24;;/h13-16,18,21,24-25,30H,6-12,17H2,1-5H3;2*1H/t18-,21-,24+,25-;;/m0../s1 |
| InChIKey | JROGBPMEKVAPEH-GXGBFOEMSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emetine hydrochloride (CHEBI:748925) has role antiviral agent (CHEBI:22587) |
| emetine hydrochloride (CHEBI:748925) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| (-)-emetine dihydrochloride | ChEMBL |
| Emetine dihydrochloride | ChEMBL |
| Hemometina | ChEMBL |
| L-emetine dihydrochloride | ChEMBL |
| NSC-756754 | ChEMBL |
| Citations |
|---|