EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 341.835 |
| Monoisotopic Mass | 341.13939 |
| SMILES | Cl.NC[C@H]1CC[C@H](C(=O)Oc2ccc(CCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C17H23NO4.ClH/c18-11-13-1-6-14(7-2-13)17(21)22-15-8-3-12(4-9-15)5-10-16(19)20;/h3-4,8-9,13-14H,1-2,5-7,10-11,18H2,(H,19,20);1H/t13-,14-; |
| InChIKey | USROQQUKEBHOFF-SKKCDYJJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cetraxate hydrochloride (CHEBI:748924) is a benzenes (CHEBI:22712) |
| cetraxate hydrochloride (CHEBI:748924) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| DV-1006 | ChEMBL |
| Neuer | ChEMBL |
| Citations |
|---|