EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24F7N3O |
| Net Charge | 0 |
| Average Mass | 491.451 |
| Monoisotopic Mass | 491.18076 |
| SMILES | Cc1cc(F)ccc1[C@H]1CNCCN1C(=O)N(C)[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F7N3O/c1-13-8-18(24)4-5-19(13)20-12-31-6-7-33(20)21(34)32(3)14(2)15-9-16(22(25,26)27)11-17(10-15)23(28,29)30/h4-5,8-11,14,20,31H,6-7,12H2,1-3H3/t14-,20-/m1/s1 |
| InChIKey | SBBYBXSFWOLDDG-JLTOFOAXSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vestipitant (CHEBI:748922) has role antidepressant (CHEBI:35469) |
| vestipitant (CHEBI:748922) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| vestipitant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gw597599 | ChEMBL |
| GW-597599 | ChEMBL |
| Citations |
|---|