EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23F3N6O |
| Net Charge | 0 |
| Average Mass | 432.450 |
| Monoisotopic Mass | 432.18854 |
| SMILES | COc1ccc(-n2nnnc2C(F)(F)F)cc1CN[C@H]1CCCN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23F3N6O/c1-31-18-10-9-16(30-20(21(22,23)24)27-28-29-30)12-15(18)13-26-17-8-5-11-25-19(17)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,17,19,25-26H,5,8,11,13H2,1H3/t17-,19-/m0/s1 |
| InChIKey | XILNRORTJVDYRH-HKUYNNGSSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vofopitant (CHEBI:748921) has role antidepressant (CHEBI:35469) |
| vofopitant (CHEBI:748921) has role antipsychotic agent (CHEBI:35476) |
| vofopitant (CHEBI:748921) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| vofopitant | WHO MedNet |
| Synonyms | Source |
|---|---|
| GR-205171 | ChEMBL |
| GR205171 | ChEMBL |
| Citations |
|---|