EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748911 - alanosine
| Formula | C3H7N3O4 |
| Net Charge | 0 |
| Average Mass | 149.106 |
| Monoisotopic Mass | 149.04366 |
| SMILES | N[C@@H](CN(O)N=O)C(=O)O |
| InChI | InChI=1S/C3H7N3O4/c4-2(3(7)8)1-6(10)5-9/h2,10H,1,4H2,(H,7,8)/t2-/m0/s1 |
| InChIKey | MLFKVJCWGUZWNV-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alanosine (CHEBI:748911) has role antineoplastic agent (CHEBI:35610) |
| alanosine (CHEBI:748911) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| alanosina | WHO MedNet |
| alanosine | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-alanosine | ChEMBL |
| NSC-153353 | ChEMBL |
| NSC-529469 | ChEMBL |
| Sdx-102 | ChEMBL |
| Citations |
|---|