EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41N5O7 |
| Net Charge | 0 |
| Average Mass | 475.587 |
| Monoisotopic Mass | 475.30060 |
| SMILES | CCN[C@@H]1C[C@H](N)[C@@H](O[C@H]2OC(CN)=CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1OC[C@](C)(O)[C@H](NC)[C@H]1O |
| InChI | InChI=1S/C21H41N5O7/c1-4-26-13-7-12(24)16(32-19-11(23)6-5-10(8-22)31-19)14(27)17(13)33-20-15(28)18(25-3)21(2,29)9-30-20/h5,11-20,25-29H,4,6-9,22-24H2,1-3H3/t11-,12+,13-,14+,15-,16-,17+,18-,19-,20-,21+/m1/s1 |
| InChIKey | CIDUJQMULVCIBT-MQDUPKMGSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| netilmicin (CHEBI:748901) has role antibacterial agent (CHEBI:33282) |
| netilmicin (CHEBI:748901) has role ophthalmology drug (CHEBI:66981) |
| netilmicin (CHEBI:748901) is a cyclohexanols (CHEBI:23480) |
| INNs | Source |
|---|---|
| netilmicina | WHO MedNet |
| netilmicine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Netira | ChEMBL |
| NSC-759586 | ChEMBL |
| Citations |
|---|