EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7489 - neamine
| Formula | C12H26N4O6 |
| Net Charge | 0 |
| Average Mass | 322.362 |
| Monoisotopic Mass | 322.18523 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H26N4O6/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h3-12,17-20H,1-2,13-16H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | SYJXFKPQNSDJLI-HKEUSBCWSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neamine (CHEBI:7489) has role antibacterial agent (CHEBI:33282) |
| neamine (CHEBI:7489) is a 2,6-dideoxy-α-D-glucoside (CHEBI:53628) |
| neamine (CHEBI:7489) is a aminoglycoside (CHEBI:47779) |
| neamine (CHEBI:7489) is conjugate base of neamine(4+) (CHEBI:65076) |
| Incoming Relation(s) |
| 6'''-oxoneomycin C (CHEBI:65098) has functional parent neamine (CHEBI:7489) |
| butirosin A (CHEBI:65112) has functional parent neamine (CHEBI:7489) |
| butirosin B (CHEBI:65110) has functional parent neamine (CHEBI:7489) |
| γ-L-glutamylbutirosin B (CHEBI:65108) has functional parent neamine (CHEBI:7489) |
| neamine sulfate (CHEBI:53635) has part neamine (CHEBI:7489) |
| neomycin (CHEBI:7507) has part neamine (CHEBI:7489) |
| neamine(4+) (CHEBI:65076) is conjugate acid of neamine (CHEBI:7489) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2,6-diamino-2,6-dideoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2-desoxy-4-O-(2,6-diamino-2,6-didesoxy-α-D-glucopyranosyl)-D-streptamin | ChemIDplus |
| 4-O-(2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl)-2-deoxy-D-streptamine | ChemIDplus |
| neamine | ChEMBL |
| Neamine | KEGG COMPOUND |
| Neomycin A | KEGG COMPOUND |
| Citations |
|---|