EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74889 - 1-dodecylguanidine acetate
| Formula | C13H29N3.C2H4O2 |
| Net Charge | 0 |
| Average Mass | 287.448 |
| Monoisotopic Mass | 287.25728 |
| SMILES | CC(=O)O.CCCCCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C13H29N3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;1-2(3)4/h2-12H2,1H3,(H4,14,15,16);1H3,(H,3,4) |
| InChIKey | YIKWKLYQRFRGPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-dodecylguanidine acetate (CHEBI:74889) has part 1-dodecylguanidine(1+) (CHEBI:74887) |
| 1-dodecylguanidine acetate (CHEBI:74889) has role antibacterial agent (CHEBI:33282) |
| 1-dodecylguanidine acetate (CHEBI:74889) has role antifungal agrochemical (CHEBI:86328) |
| 1-dodecylguanidine acetate (CHEBI:74889) is a acetate salt (CHEBI:59230) |
| 1-dodecylguanidine acetate (CHEBI:74889) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| IUPAC Name |
|---|
| 1-dodecylguanidine acetate |
| Synonyms | Source |
|---|---|
| 1-dodecylguanidinium acetate | ChemIDplus |
| aceto de N-dodecilguanidina | ChEBI |
| amino(dodecylamino)methaniminium acetate | IUPAC |
| (dodecylamino)(imino)methanaminium acetate | IUPAC |
| dodecylguanidine acetate | ChemIDplus |
| dodecylguanidine monoacetate | ChemIDplus |
| Citations |
|---|