EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74889 - 1-dodecylguanidine acetate
| Formula | C13H29N3.C2H4O2 |
| Net Charge | 0 |
| Average Mass | 287.448 |
| Monoisotopic Mass | 287.25728 |
| SMILES | CC(=O)O.CCCCCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C13H29N3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;1-2(3)4/h2-12H2,1H3,(H4,14,15,16);1H3,(H,3,4) |
| InChIKey | YIKWKLYQRFRGPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-dodecylguanidine acetate (CHEBI:74889) has part 1-dodecylguanidine(1+) (CHEBI:74887) |
| 1-dodecylguanidine acetate (CHEBI:74889) has role antibacterial agent (CHEBI:33282) |
| 1-dodecylguanidine acetate (CHEBI:74889) has role antifungal agrochemical (CHEBI:86328) |
| 1-dodecylguanidine acetate (CHEBI:74889) is a acetate salt (CHEBI:59230) |
| 1-dodecylguanidine acetate (CHEBI:74889) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| IUPAC Name |
|---|
| 1-dodecylguanidine acetate |
| Synonyms | Source |
|---|---|
| 1-dodecylguanidinium acetate | ChemIDplus |
| dodecylguanidine monoacetate | ChemIDplus |
| n-dodecylguanidinium monoacetate | ChEBI |
| n-dodecylguanidine monoacetate | ChEBI |
| n-dodecylguanidine acetate | ChemIDplus |
| n-dodecylguanidinium acetate | ChEBI |
| Citations |
|---|